C16H25N5S — CID 57059065
1-[amino(azepan-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea (PubChem CID 57059065) has the molecular formula C16H25N5S and a molecular weight of 319.48 g/mol. Its IUPAC name is 1-[amino(azepan-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea.
| Compound Name | 1-[amino(azepan-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea |
|---|---|
| PubChem CID | 57059065 |
| Molecular Formula | C16H25N5S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[amino(azepan-1-yl)methylidene]-3-(3-pyridin-2-ylpropyl)thiourea |
| SMILES | NC(=NC(=S)NCCCc1ccccn1)N1CCCCCC1 |
| InChI | InChI=1S/C16H25N5S/c17-15(21-12-5-1-2-6-13-21)20-16(22)19-11-7-9-14-8-3-4-10-18-14/h3-4,8,10H,1-2,5-7,9,11-13H2,(H3,17,19,20,22) |
| InChIKey | PEMUPGVOJMRPRZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|