C20H29N3O2 — CID 90877538
N'-benzyl-N-(2-pyridin-2-ylethyl)oxamide;ethane (PubChem CID 90877538) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N'-benzyl-N-(2-pyridin-2-ylethyl)oxamide;ethane.
| Compound Name | N'-benzyl-N-(2-pyridin-2-ylethyl)oxamide;ethane |
|---|---|
| PubChem CID | 90877538 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N'-benzyl-N-(2-pyridin-2-ylethyl)oxamide;ethane |
| SMILES | CC.CC.O=C(NCCc1ccccn1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H17N3O2.2C2H6/c20-15(18-11-9-14-8-4-5-10-17-14)16(21)19-12-13-6-2-1-3-7-13;2*1-2/h1-8,10H,9,11-12H2,(H,18,20)(H,19,21);2*1-2H3 |
| InChIKey | NACCNZVZBUQTAG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|