C15H17N3O4S — CID 91276890
2-pyridin-2-ylethylsulfamoyl N-benzylcarbamate (PubChem CID 91276890) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-pyridin-2-ylethylsulfamoyl N-benzylcarbamate.
| Compound Name | 2-pyridin-2-ylethylsulfamoyl N-benzylcarbamate |
|---|---|
| PubChem CID | 91276890 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-pyridin-2-ylethylsulfamoyl N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OS(=O)(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C15H17N3O4S/c19-15(17-12-13-6-2-1-3-7-13)22-23(20,21)18-11-9-14-8-4-5-10-16-14/h1-8,10,18H,9,11-12H2,(H,17,19) |
| InChIKey | YWUHQKXYYRPNDU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |