C20H21N3OS — CID 160926011
N-benzyl-2-(4-pyridin-2-ylbutyl)-1,3-thiazole-4-carboxamide (PubChem CID 160926011) has the molecular formula C20H21N3OS and a molecular weight of 351.47 g/mol. Its IUPAC name is N-benzyl-2-(4-pyridin-2-ylbutyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-(4-pyridin-2-ylbutyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 160926011 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-benzyl-2-(4-pyridin-2-ylbutyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1csc(CCCCc2ccccn2)n1 |
| InChI | InChI=1S/C20H21N3OS/c24-20(22-14-16-8-2-1-3-9-16)18-15-25-19(23-18)12-5-4-10-17-11-6-7-13-21-17/h1-3,6-9,11,13,15H,4-5,10,12,14H2,(H,22,24) |
| InChIKey | SSQLKIMBMPHOHO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|