C23H21F3N4OS — CID 161412485
N-benzyl-2-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]-1,3-thiazole-4-carboxamide (PubChem CID 161412485) has the molecular formula C23H21F3N4OS and a molecular weight of 458.51 g/mol. Its IUPAC name is N-benzyl-2-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 161412485 |
| Molecular Formula | C23H21F3N4OS |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-benzyl-2-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1csc(CCCCc2nc3ccc(C(F)(F)F)cc3[nH]2)n1 |
| InChI | InChI=1S/C23H21F3N4OS/c24-23(25,26)16-10-11-17-18(12-16)29-20(28-17)8-4-5-9-21-30-19(14-32-21)22(31)27-13-15-6-2-1-3-7-15/h1-3,6-7,10-12,14H,4-5,8-9,13H2,(H,27,31)(H,28,29) |
| InChIKey | VVQSOXYPGCITJJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|