C23H24N4OS — CID 162012350
2-[4-(1H-benzimidazol-2-yl)butyl]-N-benzyl-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 162012350) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)butyl]-N-benzyl-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-benzyl-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162012350 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-benzyl-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1csc(CCCCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C23H24N4OS/c1-27(15-17-9-3-2-4-10-17)23(28)20-16-29-22(26-20)14-8-7-13-21-24-18-11-5-6-12-19(18)25-21/h2-6,9-12,16H,7-8,13-15H2,1H3,(H,24,25) |
| InChIKey | YTQHGJJCCUQIHN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|