C24H32N4OS — CID 158692164
2-[4-(1H-benzimidazol-2-yl)butyl]-N-cyclohexyl-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 158692164) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)butyl]-N-cyclohexyl-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-cyclohexyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 158692164 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-cyclohexyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)N(C(=O)c1csc(CCCCc2nc3ccccc3[nH]2)n1)C1CCCCC1 |
| InChI | InChI=1S/C24H32N4OS/c1-17(2)28(18-10-4-3-5-11-18)24(29)21-16-30-23(27-21)15-9-8-14-22-25-19-12-6-7-13-20(19)26-22/h6-7,12-13,16-18H,3-5,8-11,14-15H2,1-2H3,(H,25,26) |
| InChIKey | IGMIUIAVUFIPKY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|