C24H27N5OS — CID 147616507
2-[4-(1H-benzimidazol-2-yl)butyl]-N-[[2-(dimethylamino)phenyl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 147616507) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)butyl]-N-[[2-(dimethylamino)phenyl]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-[[2-(dimethylamino)phenyl]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 147616507 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)butyl]-N-[[2-(dimethylamino)phenyl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccccc1CNC(=O)c1csc(CCCCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C24H27N5OS/c1-29(2)21-12-6-3-9-17(21)15-25-24(30)20-16-31-23(28-20)14-8-7-13-22-26-18-10-4-5-11-19(18)27-22/h3-6,9-12,16H,7-8,13-15H2,1-2H3,(H,25,30)(H,26,27) |
| InChIKey | GDAMOJMSIMONCE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|