C25H28N6OS — CID 129052310
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052310) has the molecular formula C25H28N6OS and a molecular weight of 460.61 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052310 |
| Molecular Formula | C25H28N6OS |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1N1CCCC1)c1csc(CCNCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C25H28N6OS/c32-25(27-15-18-7-1-4-10-22(18)31-13-5-6-14-31)21-17-33-24(30-21)11-12-26-16-23-28-19-8-2-3-9-20(19)29-23/h1-4,7-10,17,26H,5-6,11-16H2,(H,27,32)(H,28,29) |
| InChIKey | UHVHYOXGSGAEEB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|