C26H36N6OS — CID 129076339
N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-[2-[2-[(3Z)-penta-1,3-dien-2-yl]iminopropylamino]ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 129076339) has the molecular formula C26H36N6OS and a molecular weight of 480.68 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-[2-[2-[(3Z)-penta-1,3-dien-2-yl]iminopropylamino]ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-[2-[2-[(3Z)-penta-1,3-dien-2-yl]iminopropylamino]ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129076339 |
| Molecular Formula | C26H36N6OS |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-[2-[2-[(3Z)-penta-1,3-dien-2-yl]iminopropylamino]ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | C=C(/C=C\C)/N=C(\C)CNCCc1nc(C(=O)NCc2ccccc2N2CCN(C)CC2)cs1 |
| InChI | InChI=1S/C26H36N6OS/c1-5-8-20(2)29-21(3)17-27-12-11-25-30-23(19-34-25)26(33)28-18-22-9-6-7-10-24(22)32-15-13-31(4)14-16-32/h5-10,19,27H,2,11-18H2,1,3-4H3,(H,28,33)/b8-5-,29-21+ |
| InChIKey | CBWZZPFHORDQGN-SCNGXZPBSA-N |
| XLogP | 3.51 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|