C20H22ClN5OS — CID 56517826
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide (PubChem CID 56517826) has the molecular formula C20H22ClN5OS and a molecular weight of 415.95 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 56517826 |
| Molecular Formula | C20H22ClN5OS |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccccc2CNC(=O)/C=C/c2c(Cl)nc3sccn23)CC1 |
| InChI | InChI=1S/C20H22ClN5OS/c1-24-8-10-25(11-9-24)16-5-3-2-4-15(16)14-22-18(27)7-6-17-19(21)23-20-26(17)12-13-28-20/h2-7,12-13H,8-11,14H2,1H3,(H,22,27)/b7-6+ |
| InChIKey | SNDPYVSWHUESGI-VOTSOKGWSA-N |
| XLogP | 3.13 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|