C16H12ClN3OS — CID 34816692
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 34816692) has the molecular formula C16H12ClN3OS and a molecular weight of 329.81 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 34816692 |
| Molecular Formula | C16H12ClN3OS |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H12ClN3OS/c17-15-13(20-9-10-22-16(20)18-15)5-6-14(21)19-8-7-11-3-1-2-4-12(11)19/h1-6,9-10H,7-8H2/b6-5+ |
| InChIKey | RALHMWFKHLYWLB-AATRIKPKSA-N |
| XLogP | 3.65 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|