C18H16ClFN4O3S2 — CID 37348679
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 37348679) has the molecular formula C18H16ClFN4O3S2 and a molecular weight of 454.94 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 37348679 |
| Molecular Formula | C18H16ClFN4O3S2 |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H16ClFN4O3S2/c19-17-14(24-11-12-28-18(24)21-17)5-6-16(25)22-7-9-23(10-8-22)29(26,27)15-4-2-1-3-13(15)20/h1-6,11-12H,7-10H2/b6-5+ |
| InChIKey | ABJUCMLFFBATAA-AATRIKPKSA-N |
| XLogP | 2.73 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|