About N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide
N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide (PubChem CID 31794685) has the molecular formula C15H10ClFN4O2S
and a molecular weight of 364.79 g/mol. Its IUPAC name is N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide |
| PubChem CID | 31794685 |
| Molecular Formula | C15H10ClFN4O2S |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H10ClFN4O2S/c16-13-11(21-7-8-24-15(21)18-13)5-6-12(22)19-20-14(23)9-3-1-2-4-10(9)17/h1-8H,(H,19,22)(H,20,23)/b6-5+ |
| InChIKey | PGDHKROQFZGUGE-AATRIKPKSA-N |
| XLogP | 2.66 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide?
The IUPAC name of N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide (CID 31794685) is N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide.
What is the SMILES notation for N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide?
The canonical SMILES for N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide is O=C(/C=C/c1c(Cl)nc2sccn12)NNC(=O)c1ccccc1F.
What is the InChIKey of N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide?
The InChIKey is PGDHKROQFZGUGE-AATRIKPKSA-N. The full InChI is InChI=1S/C15H10ClFN4O2S/c16-13-11(21-7-8-24-15(21)18-13)5-6-12(22)19-20-14(23)9-3-1-2-4-10(9)17/h1-8H,(H,19,22)(H,20,23)/b6-5+.
What are the key properties of N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide?
N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide has a molecular weight of 364.79 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-2-fluorobenzohydrazide is sourced from PubChem (CID 31794685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).