C14H8BrClN2OS — CID 8856635
(E)-1-(2-bromophenyl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one (PubChem CID 8856635) has the molecular formula C14H8BrClN2OS and a molecular weight of 367.66 g/mol. Its IUPAC name is (E)-1-(2-bromophenyl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-bromophenyl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8856635 |
| Molecular Formula | C14H8BrClN2OS |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | (E)-1-(2-bromophenyl)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)c1ccccc1Br |
| InChI | InChI=1S/C14H8BrClN2OS/c15-10-4-2-1-3-9(10)12(19)6-5-11-13(16)17-14-18(11)7-8-20-14/h1-8H/b6-5+ |
| InChIKey | MIGAABMXGYGVHX-AATRIKPKSA-N |
| XLogP | 4.71 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|