C16H13ClN2O3S — CID 8859633
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8859633) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8859633 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2c(Cl)nc3sccn23)c1 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-21-10-3-6-14(22-2)11(9-10)13(20)5-4-12-15(17)18-16-19(12)7-8-23-16/h3-9H,1-2H3/b5-4+ |
| InChIKey | DWBHUCCUIHTRBY-SNAWJCMRSA-N |
| XLogP | 3.96 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|