C24H22N2O5S — CID 70896459
3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 70896459) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70896459 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2nc3sccn3c2C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-28-17-7-5-15(6-8-17)22-18(26-11-12-32-24(26)25-22)9-10-19(27)16-13-20(29-2)23(31-4)21(14-16)30-3/h5-14H,1-4H3 |
| InChIKey | XFQIHTLSGRJKNZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|