C24H14ClN3O3S — CID 51352714
(E)-3-[6-(4-chloro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 51352714) has the molecular formula C24H14ClN3O3S and a molecular weight of 459.91 g/mol. Its IUPAC name is (E)-3-[6-(4-chloro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[6-(4-chloro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 51352714 |
| Molecular Formula | C24H14ClN3O3S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | (E)-3-[6-(4-chloro-3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(-c2ccc(Cl)c([N+](=O)[O-])c2)nc2sccn12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H14ClN3O3S/c25-19-8-7-18(14-21(19)28(30)31)23-20(27-11-12-32-24(27)26-23)9-10-22(29)17-6-5-15-3-1-2-4-16(15)13-17/h1-14H/b10-9+ |
| InChIKey | GOSZJWOUCKQXET-MDZDMXLPSA-N |
| XLogP | 6.67 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|