C19H13ClN4O3S — CID 51353160
(E)-3-[6-(4-chloro-3-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-pyrrol-2-yl)prop-2-en-1-one (PubChem CID 51353160) has the molecular formula C19H13ClN4O3S and a molecular weight of 412.86 g/mol. Its IUPAC name is (E)-3-[6-(4-chloro-3-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-pyrrol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[6-(4-chloro-3-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-pyrrol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51353160 |
| Molecular Formula | C19H13ClN4O3S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (E)-3-[6-(4-chloro-3-nitrophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-pyrrol-2-yl)prop-2-en-1-one |
| SMILES | Cc1cn2c(/C=C/C(=O)c3ccc[nH]3)c(-c3ccc(Cl)c([N+](=O)[O-])c3)nc2s1 |
| InChI | InChI=1S/C19H13ClN4O3S/c1-11-10-23-15(6-7-17(25)14-3-2-8-21-14)18(22-19(23)28-11)12-4-5-13(20)16(9-12)24(26)27/h2-10,21H,1H3/b7-6+ |
| InChIKey | HTGBHMLDBOYTNU-VOTSOKGWSA-N |
| XLogP | 5.16 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|