C24H18N4O4S — CID 70933005
(E)-3-[6-[4-(hydroxymethyl)-3-nitrophenyl]-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-indol-3-yl)prop-2-en-1-one (PubChem CID 70933005) has the molecular formula C24H18N4O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is (E)-3-[6-[4-(hydroxymethyl)-3-nitrophenyl]-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-indol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[6-[4-(hydroxymethyl)-3-nitrophenyl]-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-indol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70933005 |
| Molecular Formula | C24H18N4O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (E)-3-[6-[4-(hydroxymethyl)-3-nitrophenyl]-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]-1-(1H-indol-3-yl)prop-2-en-1-one |
| SMILES | Cc1cn2c(/C=C/C(=O)c3c[nH]c4ccccc34)c(-c3ccc(CO)c([N+](=O)[O-])c3)nc2s1 |
| InChI | InChI=1S/C24H18N4O4S/c1-14-12-27-20(8-9-22(30)18-11-25-19-5-3-2-4-17(18)19)23(26-24(27)33-14)15-6-7-16(13-29)21(10-15)28(31)32/h2-12,25,29H,13H2,1H3/b9-8+ |
| InChIKey | RYGOLRZMRMAVKP-CMDGGOBGSA-N |
| XLogP | 5.15 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|