C19H14N2O — CID 4206840
1,3-bis(1H-indol-3-yl)prop-2-en-1-one (PubChem CID 4206840) has the molecular formula C19H14N2O and a molecular weight of 286.33 g/mol. Its IUPAC name is 1,3-bis(1H-indol-3-yl)prop-2-en-1-one.
| Compound Name | 1,3-bis(1H-indol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4206840 |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1,3-bis(1H-indol-3-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H14N2O/c22-19(16-12-21-18-8-4-2-6-15(16)18)10-9-13-11-20-17-7-3-1-5-14(13)17/h1-12,20-21H |
| InChIKey | QXTGQLSOKNQOOZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|