C19H11Cl2N3O2S — CID 1473296
[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] 3,4-dichlorobenzoate (PubChem CID 1473296) has the molecular formula C19H11Cl2N3O2S and a molecular weight of 416.29 g/mol. Its IUPAC name is [(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] 3,4-dichlorobenzoate.
| Compound Name | [(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 1473296 |
| Molecular Formula | C19H11Cl2N3O2S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | [(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino] 3,4-dichlorobenzoate |
| SMILES | O=C(ON=Cc1c(-c2ccccc2)nc2sccn12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H11Cl2N3O2S/c20-14-7-6-13(10-15(14)21)18(25)26-22-11-16-17(12-4-2-1-3-5-12)23-19-24(16)8-9-27-19/h1-11H |
| InChIKey | BWZCOAZDTCAAEZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|