C19H12ClFN4OS — CID 162661101
4-chloro-N-[(E)-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]benzamide (PubChem CID 162661101) has the molecular formula C19H12ClFN4OS and a molecular weight of 398.85 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 162661101 |
| Molecular Formula | C19H12ClFN4OS |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 4-chloro-N-[(E)-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1c(-c2ccc(F)cc2)nc2sccn12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H12ClFN4OS/c20-14-5-1-13(2-6-14)18(26)24-22-11-16-17(12-3-7-15(21)8-4-12)23-19-25(16)9-10-27-19/h1-11H,(H,24,26)/b22-11+ |
| InChIKey | PZSOZTZJGGOTEZ-SSDVNMTOSA-N |
| XLogP | 4.62 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|