C18H14ClN3OS — CID 9175195
N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-4-methylbenzamide (PubChem CID 9175195) has the molecular formula C18H14ClN3OS and a molecular weight of 355.85 g/mol. Its IUPAC name is N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-4-methylbenzamide.
| Compound Name | N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 9175195 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C\c2csc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C18H14ClN3OS/c1-12-2-4-13(5-3-12)17(23)22-20-10-16-11-24-18(21-16)14-6-8-15(19)9-7-14/h2-11H,1H3,(H,22,23)/b20-10- |
| InChIKey | BBMWVBLDUFTNQN-JMIUGGIZSA-N |
| XLogP | 4.54 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|