C19H15ClN2O2S — CID 126196378
4-chloro-N-[(Z)-[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]benzamide (PubChem CID 126196378) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126196378 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-chloro-N-[(Z)-[5-(4-methylphenyl)sulfanylfuran-2-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(Sc2ccc(/C=N\NC(=O)c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c1-13-2-9-17(10-3-13)25-18-11-8-16(24-18)12-21-22-19(23)14-4-6-15(20)7-5-14/h2-12H,1H3,(H,22,23)/b21-12- |
| InChIKey | LGNVGXIUXAYCLL-MTJSOVHGSA-N |
| XLogP | 5.16 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|