C20H15ClN2OS — CID 126197594
4-chloro-N-[(Z)-(4-phenylsulfanylphenyl)methylideneamino]benzamide (PubChem CID 126197594) has the molecular formula C20H15ClN2OS and a molecular weight of 366.87 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-(4-phenylsulfanylphenyl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-(4-phenylsulfanylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126197594 |
| Molecular Formula | C20H15ClN2OS |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-chloro-N-[(Z)-(4-phenylsulfanylphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Sc2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN2OS/c21-17-10-8-16(9-11-17)20(24)23-22-14-15-6-12-19(13-7-15)25-18-4-2-1-3-5-18/h1-14H,(H,23,24)/b22-14- |
| InChIKey | WNBFVMDBAXFGNT-HMAPJEAMSA-N |
| XLogP | 5.26 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|