C18H12ClIN2O3S — CID 74017319
N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-3-hydroxy-4-iodobenzamide (PubChem CID 74017319) has the molecular formula C18H12ClIN2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-3-hydroxy-4-iodobenzamide.
| Compound Name | N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 74017319 |
| Molecular Formula | C18H12ClIN2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-3-hydroxy-4-iodobenzamide |
| SMILES | O=C(NN=Cc1ccc(Sc2ccc(Cl)cc2)o1)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C18H12ClIN2O3S/c19-12-2-5-14(6-3-12)26-17-8-4-13(25-17)10-21-22-18(24)11-1-7-15(20)16(23)9-11/h1-10,23H,(H,22,24) |
| InChIKey | YTDPDUUJJNYVBT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|