C19H12Cl4N2O3S — CID 40988830
N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide (PubChem CID 40988830) has the molecular formula C19H12Cl4N2O3S and a molecular weight of 490.20 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 40988830 |
| Molecular Formula | C19H12Cl4N2O3S |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1Cl)N/N=C\c1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C19H12Cl4N2O3S/c20-11-1-4-14(5-2-11)29-18-6-3-13(28-18)9-24-25-17(26)10-27-16-8-12(21)7-15(22)19(16)23/h1-9H,10H2,(H,25,26)/b24-9- |
| InChIKey | USVDJJMCPJUDDH-OPVMPGTRSA-N |
| XLogP | 6.57 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|