C22H16ClN3O3S — CID 126191266
N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-quinolin-8-yloxyacetamide (PubChem CID 126191266) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 126191266 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-quinolin-8-yloxyacetamide |
| SMILES | O=C(COc1cccc2cccnc12)N/N=C\c1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H16ClN3O3S/c23-16-6-9-18(10-7-16)30-21-11-8-17(29-21)13-25-26-20(27)14-28-19-5-1-3-15-4-2-12-24-22(15)19/h1-13H,14H2,(H,26,27)/b25-13- |
| InChIKey | PFHJJMGJMJZABG-MXAYSNPKSA-N |
| XLogP | 5.16 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|