C19H14ClIN2O3S — CID 126194323
N-[(E)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2-iodophenoxy)acetamide (PubChem CID 126194323) has the molecular formula C19H14ClIN2O3S and a molecular weight of 512.76 g/mol. Its IUPAC name is N-[(E)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2-iodophenoxy)acetamide.
| Compound Name | N-[(E)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2-iodophenoxy)acetamide |
|---|---|
| PubChem CID | 126194323 |
| Molecular Formula | C19H14ClIN2O3S |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | N-[(E)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-(2-iodophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1I)N/N=C/c1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C19H14ClIN2O3S/c20-13-5-8-15(9-6-13)27-19-10-7-14(26-19)11-22-23-18(24)12-25-17-4-2-1-3-16(17)21/h1-11H,12H2,(H,23,24)/b22-11+ |
| InChIKey | WTFHFCRVWBJMKU-SSDVNMTOSA-N |
| XLogP | 5.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|