C34H24ClN3O2S — CID 126192668
N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide (PubChem CID 126192668) has the molecular formula C34H24ClN3O2S and a molecular weight of 574.11 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide.
| Compound Name | N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 126192668 |
| Molecular Formula | C34H24ClN3O2S |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | N-[(Z)-[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide |
| SMILES | O=C(N/N=C\c1ccc(Sc2ccc(Cl)cc2)o1)c1ccc(-n2c(-c3ccccc3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H24ClN3O2S/c35-27-13-18-30(19-14-27)41-33-22-17-29(40-33)23-36-37-34(39)26-11-15-28(16-12-26)38-31(24-7-3-1-4-8-24)20-21-32(38)25-9-5-2-6-10-25/h1-23H,(H,37,39)/b36-23- |
| InChIKey | BUKTYFZCAOTMBW-GMEAVFFOSA-N |
| XLogP | 8.97 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|