C17H14ClN3O2S — CID 8518693
N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 8518693) has the molecular formula C17H14ClN3O2S and a molecular weight of 359.84 g/mol. Its IUPAC name is N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 8518693 |
| Molecular Formula | C17H14ClN3O2S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2csc(-c3ccc(Cl)cc3)n2)c(C)o1 |
| InChI | InChI=1S/C17H14ClN3O2S/c1-10-7-15(11(2)23-10)16(22)21-19-8-14-9-24-17(20-14)12-3-5-13(18)6-4-12/h3-9H,1-2H3,(H,21,22)/b19-8- |
| InChIKey | XMZIXZCKIURGLF-UWVJOHFNSA-N |
| XLogP | 4.44 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|