C19H16ClN3O3S — CID 9315889
N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide (PubChem CID 9315889) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 9315889 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-[(Z)-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)N/N=C\c2csc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H16ClN3O3S/c1-25-16-6-8-17(9-7-16)26-11-18(24)23-21-10-15-12-27-19(22-15)13-2-4-14(20)5-3-13/h2-10,12H,11H2,1H3,(H,23,24)/b21-10- |
| InChIKey | DKXINFLDPCDQLT-FBHDLOMBSA-N |
| XLogP | 4.00 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|