C13H11Cl2N3O2S — CID 9060397
2-(2,4-dichlorophenoxy)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide (PubChem CID 9060397) has the molecular formula C13H11Cl2N3O2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9060397 |
| Molecular Formula | C13H11Cl2N3O2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1nc(/C=N\NC(=O)COc2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C13H11Cl2N3O2S/c1-8-17-10(7-21-8)5-16-18-13(19)6-20-12-3-2-9(14)4-11(12)15/h2-5,7H,6H2,1H3,(H,18,19)/b16-5- |
| InChIKey | MMTSXILFXJRFTG-BNCCVWRVSA-N |
| XLogP | 3.29 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|