C10H6ClNOS — CID 2115215
2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 2115215) has the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 2115215 |
| Molecular Formula | C10H6ClNOS |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C10H6ClNOS/c11-8-3-1-7(2-4-8)10-12-9(5-13)6-14-10/h1-6H |
| InChIKey | QVEJNZQGJYCMKA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|