C19H13ClN2OS — CID 18279198
(3Z)-3-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylidene]-1-methylindol-2-one (PubChem CID 18279198) has the molecular formula C19H13ClN2OS and a molecular weight of 352.85 g/mol. Its IUPAC name is (3Z)-3-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-3-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 18279198 |
| Molecular Formula | C19H13ClN2OS |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (3Z)-3-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylidene]-1-methylindol-2-one |
| SMILES | CN1C(=O)/C(=C\c2csc(-c3ccc(Cl)cc3)n2)c2ccccc21 |
| InChI | InChI=1S/C19H13ClN2OS/c1-22-17-5-3-2-4-15(17)16(19(22)23)10-14-11-24-18(21-14)12-6-8-13(20)9-7-12/h2-11H,1H3/b16-10- |
| InChIKey | DJSRNMFBRNBGJW-YBEGLDIGSA-N |
| XLogP | 4.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|