C22H16N2O5S — CID 39967011
2-[(4E)-4-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid (PubChem CID 39967011) has the molecular formula C22H16N2O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-[(4E)-4-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid.
| Compound Name | 2-[(4E)-4-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 39967011 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-[(4E)-4-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetic acid |
| SMILES | COc1cccc(-c2nc(/C=C3/C(=O)N(CC(=O)O)C(=O)c4ccccc43)cs2)c1 |
| InChI | InChI=1S/C22H16N2O5S/c1-29-15-6-4-5-13(9-15)20-23-14(12-30-20)10-18-16-7-2-3-8-17(16)21(27)24(22(18)28)11-19(25)26/h2-10,12H,11H2,1H3,(H,25,26)/b18-10+ |
| InChIKey | NGAJXBVVEWUSJV-VCHYOVAHSA-N |
| XLogP | 3.43 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|