C12H11NO4S — CID 16768004
2-[4-(3-methoxyphenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid (PubChem CID 16768004) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-(3-methoxyphenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 16768004 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)-2-oxo-1,3-thiazol-3-yl]acetic acid |
| SMILES | COc1cccc(-c2csc(=O)n2CC(=O)O)c1 |
| InChI | InChI=1S/C12H11NO4S/c1-17-9-4-2-3-8(5-9)10-7-18-12(16)13(10)6-11(14)15/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | NPJCLDQDKJBODK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |