C14H15NO5S — CID 43286918
3-[4-(2,4-dimethoxyphenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid (PubChem CID 43286918) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[4-(2,4-dimethoxyphenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid.
| Compound Name | 3-[4-(2,4-dimethoxyphenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 43286918 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[4-(2,4-dimethoxyphenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid |
| SMILES | COc1ccc(-c2csc(=O)n2CCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C14H15NO5S/c1-19-9-3-4-10(12(7-9)20-2)11-8-21-14(18)15(11)6-5-13(16)17/h3-4,7-8H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | SWRYNIYCGPZICY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |