C16H20N2O4 — CID 82467142
3-amino-6-(2,4-dimethoxyphenyl)-1-(2-methoxyethyl)pyridin-2-one (PubChem CID 82467142) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-amino-6-(2,4-dimethoxyphenyl)-1-(2-methoxyethyl)pyridin-2-one.
| Compound Name | 3-amino-6-(2,4-dimethoxyphenyl)-1-(2-methoxyethyl)pyridin-2-one |
|---|---|
| PubChem CID | 82467142 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-amino-6-(2,4-dimethoxyphenyl)-1-(2-methoxyethyl)pyridin-2-one |
| SMILES | COCCn1c(-c2ccc(OC)cc2OC)ccc(N)c1=O |
| InChI | InChI=1S/C16H20N2O4/c1-20-9-8-18-14(7-6-13(17)16(18)19)12-5-4-11(21-2)10-15(12)22-3/h4-7,10H,8-9,17H2,1-3H3 |
| InChIKey | CTLWZULGIIDTMX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |