C8H13NO6S — CID 160678823
2,4-dimethoxyaniline;sulfuric acid (PubChem CID 160678823) has the molecular formula C8H13NO6S and a molecular weight of 251.26 g/mol. Its IUPAC name is 2,4-dimethoxyaniline;sulfuric acid.
| Compound Name | 2,4-dimethoxyaniline;sulfuric acid |
|---|---|
| PubChem CID | 160678823 |
| Molecular Formula | C8H13NO6S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2,4-dimethoxyaniline;sulfuric acid |
| SMILES | COc1ccc(N)c(OC)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H11NO2.H2O4S/c1-10-6-3-4-7(9)8(5-6)11-2;1-5(2,3)4/h3-5H,9H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | RNWJJOZSBHRFCP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|