C8H11NO4S — CID 154180225
(2-amino-4-methoxyphenyl)methanesulfonic acid (PubChem CID 154180225) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is (2-amino-4-methoxyphenyl)methanesulfonic acid.
| Compound Name | (2-amino-4-methoxyphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 154180225 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (2-amino-4-methoxyphenyl)methanesulfonic acid |
| SMILES | COc1ccc(CS(=O)(=O)O)c(N)c1 |
| InChI | InChI=1S/C8H11NO4S/c1-13-7-3-2-6(8(9)4-7)5-14(10,11)12/h2-4H,5,9H2,1H3,(H,10,11,12) |
| InChIKey | HUKGVLVNYWYIQI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|