C12H9ClN2O5S — CID 43286917
3-[4-(4-chloro-3-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid (PubChem CID 43286917) has the molecular formula C12H9ClN2O5S and a molecular weight of 328.73 g/mol. Its IUPAC name is 3-[4-(4-chloro-3-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid.
| Compound Name | 3-[4-(4-chloro-3-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 43286917 |
| Molecular Formula | C12H9ClN2O5S |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 3-[4-(4-chloro-3-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]propanoic acid |
| SMILES | O=C(O)CCn1c(-c2ccc(Cl)c([N+](=O)[O-])c2)csc1=O |
| InChI | InChI=1S/C12H9ClN2O5S/c13-8-2-1-7(5-9(8)15(19)20)10-6-21-12(18)14(10)4-3-11(16)17/h1-2,5-6H,3-4H2,(H,16,17) |
| InChIKey | ACOUGURCVQFSEL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|