C18H13ClN2O5S — CID 16961700
(2-chloro-4-nitrophenyl) 2-[4-(4-methylphenyl)-2-oxo-1,3-thiazol-3-yl]acetate (PubChem CID 16961700) has the molecular formula C18H13ClN2O5S and a molecular weight of 404.83 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) 2-[4-(4-methylphenyl)-2-oxo-1,3-thiazol-3-yl]acetate.
| Compound Name | (2-chloro-4-nitrophenyl) 2-[4-(4-methylphenyl)-2-oxo-1,3-thiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16961700 |
| Molecular Formula | C18H13ClN2O5S |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (2-chloro-4-nitrophenyl) 2-[4-(4-methylphenyl)-2-oxo-1,3-thiazol-3-yl]acetate |
| SMILES | Cc1ccc(-c2csc(=O)n2CC(=O)Oc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O5S/c1-11-2-4-12(5-3-11)15-10-27-18(23)20(15)9-17(22)26-16-7-6-13(21(24)25)8-14(16)19/h2-8,10H,9H2,1H3 |
| InChIKey | ISFSUEAYMXMTQJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|