4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid

C13H12N2O5S — CID 43286997

IUPAC4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid
SMILESO=C(O)CCCn1c(-c2ccc([N+](=O)[O-])cc2)csc1=O
InChIInChI=1S/C13H12N2O5S/c16-12(17)2-1-7-14-11(8-21-13(14)18)9-3-5-10(6-4-9)15(19)20/h3-6,8H,1-2,7H2,(H,16,17)
InChIKeyVFONPYCYGQXTPX-UHFFFAOYSA-N
MW308.31 g/mol
LogP2.35
Rot. Bonds6

About 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid

4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid (PubChem CID 43286997) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid.

Molecular Properties

Compound Name4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid
PubChem CID43286997
Molecular FormulaC13H12N2O5S
Molecular Weight308.31 g/mol
Exact Mass308.05
IUPAC Name4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid
SMILESO=C(O)CCCn1c(-c2ccc([N+](=O)[O-])cc2)csc1=O
InChIInChI=1S/C13H12N2O5S/c16-12(17)2-1-7-14-11(8-21-13(14)18)9-3-5-10(6-4-9)15(19)20/h3-6,8H,1-2,7H2,(H,16,17)
InChIKeyVFONPYCYGQXTPX-UHFFFAOYSA-N
XLogP2.35
TPSA102.44 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.31
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid?
The IUPAC name of 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid (CID 43286997) is 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid.
What is the SMILES notation for 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid?
The canonical SMILES for 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid is O=C(O)CCCn1c(-c2ccc([N+](=O)[O-])cc2)csc1=O.
What is the InChIKey of 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid?
The InChIKey is VFONPYCYGQXTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5S/c16-12(17)2-1-7-14-11(8-21-13(14)18)9-3-5-10(6-4-9)15(19)20/h3-6,8H,1-2,7H2,(H,16,17).
What are the key properties of 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid?
4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid has a molecular weight of 308.31 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-nitrophenyl)-2-oxo-1,3-thiazol-3-yl]butanoic acid is sourced from PubChem (CID 43286997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).