C19H20N2OS — CID 82027928
3-(4-aminobutyl)-4-(4-phenylphenyl)-1,3-thiazol-2-one (PubChem CID 82027928) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-(4-aminobutyl)-4-(4-phenylphenyl)-1,3-thiazol-2-one.
| Compound Name | 3-(4-aminobutyl)-4-(4-phenylphenyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 82027928 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-(4-aminobutyl)-4-(4-phenylphenyl)-1,3-thiazol-2-one |
| SMILES | NCCCCn1c(-c2ccc(-c3ccccc3)cc2)csc1=O |
| InChI | InChI=1S/C19H20N2OS/c20-12-4-5-13-21-18(14-23-19(21)22)17-10-8-16(9-11-17)15-6-2-1-3-7-15/h1-3,6-11,14H,4-5,12-13,20H2 |
| InChIKey | SHPQYIKTSHOFHZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|