C15H20N2OS — CID 82027932
3-(4-aminobutyl)-4-(2,4-dimethylphenyl)-1,3-thiazol-2-one (PubChem CID 82027932) has the molecular formula C15H20N2OS and a molecular weight of 276.41 g/mol. Its IUPAC name is 3-(4-aminobutyl)-4-(2,4-dimethylphenyl)-1,3-thiazol-2-one.
| Compound Name | 3-(4-aminobutyl)-4-(2,4-dimethylphenyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 82027932 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-(4-aminobutyl)-4-(2,4-dimethylphenyl)-1,3-thiazol-2-one |
| SMILES | Cc1ccc(-c2csc(=O)n2CCCCN)c(C)c1 |
| InChI | InChI=1S/C15H20N2OS/c1-11-5-6-13(12(2)9-11)14-10-19-15(18)17(14)8-4-3-7-16/h5-6,9-10H,3-4,7-8,16H2,1-2H3 |
| InChIKey | YRMXZJIHAOTXEQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|