C19H26N2O — CID 82520208
3-(aminomethyl)-6-(2,4-dimethylphenyl)-1-pentylpyridin-2-one (PubChem CID 82520208) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(2,4-dimethylphenyl)-1-pentylpyridin-2-one.
| Compound Name | 3-(aminomethyl)-6-(2,4-dimethylphenyl)-1-pentylpyridin-2-one |
|---|---|
| PubChem CID | 82520208 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-(aminomethyl)-6-(2,4-dimethylphenyl)-1-pentylpyridin-2-one |
| SMILES | CCCCCn1c(-c2ccc(C)cc2C)ccc(CN)c1=O |
| InChI | InChI=1S/C19H26N2O/c1-4-5-6-11-21-18(10-8-16(13-20)19(21)22)17-9-7-14(2)12-15(17)3/h7-10,12H,4-6,11,13,20H2,1-3H3 |
| InChIKey | DVZYUYYCECXPDC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|