C13H15ClN2OS — CID 82027926
3-(4-aminobutyl)-4-(4-chlorophenyl)-1,3-thiazol-2-one (PubChem CID 82027926) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is 3-(4-aminobutyl)-4-(4-chlorophenyl)-1,3-thiazol-2-one.
| Compound Name | 3-(4-aminobutyl)-4-(4-chlorophenyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 82027926 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(4-aminobutyl)-4-(4-chlorophenyl)-1,3-thiazol-2-one |
| SMILES | NCCCCn1c(-c2ccc(Cl)cc2)csc1=O |
| InChI | InChI=1S/C13H15ClN2OS/c14-11-5-3-10(4-6-11)12-9-18-13(17)16(12)8-2-1-7-15/h3-6,9H,1-2,7-8,15H2 |
| InChIKey | NPNMVUWQWYEPNP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|