C16H13ClN2OS — CID 92936592
4-(4-aminophenyl)-3-[(3-chlorophenyl)methyl]-1,3-thiazol-2-one (PubChem CID 92936592) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is 4-(4-aminophenyl)-3-[(3-chlorophenyl)methyl]-1,3-thiazol-2-one.
| Compound Name | 4-(4-aminophenyl)-3-[(3-chlorophenyl)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 92936592 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-(4-aminophenyl)-3-[(3-chlorophenyl)methyl]-1,3-thiazol-2-one |
| SMILES | Nc1ccc(-c2csc(=O)n2Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H13ClN2OS/c17-13-3-1-2-11(8-13)9-19-15(10-21-16(19)20)12-4-6-14(18)7-5-12/h1-8,10H,9,18H2 |
| InChIKey | ZZSGDNAJPHZQFU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|